![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 363CALibration procedure.pdf | 2014-04-11 09:51 | 133K | |
| Detector Cell Volume.pdf | 2014-04-11 09:52 | 87K | |
| Detector Sample Load.pdf | 2014-04-11 09:52 | 92K | |
| HPLC Tubing.pdf | 2014-04-11 09:52 | 26K | |
| IUPAC Definitions of LOD LOI and LOQ.pdf | 2014-04-11 09:52 | 52K | |
| L-7485 (PS 363) Optical Alignment RevA.pdf | 2014-04-11 09:52 | 200K | |
| Max Injection Volumes.pdf | 2014-04-11 09:52 | 92K | |
| Optimising LC Conditions.pdf | 2014-04-11 09:52 | 79K | |
| PS 410 Horizontal Movement Bush Replacement Procedure.pdf | 2014-04-11 09:52 | 141K | |
| Solvent Eluent Viscosity.pdf | 2014-04-11 09:52 | 14K | |
| Solvent Polarities Elution Strengths and UV cutoff.pdf | 2014-04-11 09:52 | 37K | |
| Solvent Resistance of some Polymers.pdf | 2014-04-11 09:52 | 246K | |
| TechTip_Smaller_IDs.pdf | 2014-04-11 09:52 | 170K | |
| Tech support required info.pdf | 2014-04-11 09:52 | 15K | |
| Tubing and Column Volumes.pdf | 2014-04-11 09:52 | 6.1K | |
| UV and Vis Optical Path.pdf | 2014-04-11 09:52 | 124K | |
| _vti_cnf/ | 2014-06-14 03:43 | - | |
| autosampler return form.pdf | 2014-04-11 09:51 | 69K | |